What is the molecular formula of 3-Bromo-4-chloropyridine?
The molecular formula is C5H3BrClN.
What is the molecular mass of 3-Bromo-4-chloropyridine?
The molecular mass is 192.44 g/mol.
What is the IUPAC name of 3-Bromo-4-chloropyridine?
The IUPAC name is 3-bromo-4-chloropyridine.
What is the InChI of 3-Bromo-4-chloropyridine?
The InChI is InChI=1S/C5H3BrClN/c6-4-3-8-2-1-5(4)7/h1-3H.
What is the InChIKey of 3-Bromo-4-chloropyridine?
The InChIKey is QADXKWUCCGPQNR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-4-chloropyridine?
The canonical SMILES is C1=CN=CC(=C1Cl)Br.
What is the CAS number of 3-Bromo-4-chloropyridine?
The CAS number is 36953-42-1.
What is the European Community (EC) number of 3-Bromo-4-chloropyridine?
The European Community (EC) number is 690-646-5.
What is the DSSTox Substance ID of 3-Bromo-4-chloropyridine?
The DSSTox Substance ID is DTXSID00958133.
Is 3-Bromo-4-chloropyridine a canonicalized compound?
Yes, 3-Bromo-4-chloropyridine is a canonicalized compound according to PubChem.