What is the molecular formula of 3-Bromo-2-nitroaniline?
The molecular formula of 3-Bromo-2-nitroaniline is C6H5BrN2O2.
What is the molecular weight of 3-Bromo-2-nitroaniline?
The molecular weight of 3-Bromo-2-nitroaniline is 217.02 g/mol.
What is the IUPAC name of 3-Bromo-2-nitroaniline?
The IUPAC name of 3-Bromo-2-nitroaniline is 3-bromo-2-nitroaniline.
What is the InChI of 3-Bromo-2-nitroaniline?
The InChI of 3-Bromo-2-nitroaniline is InChI=1S/C6H5BrN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2.
What is the InChIKey of 3-Bromo-2-nitroaniline?
The InChIKey of 3-Bromo-2-nitroaniline is GLKHLBAXHLAQBJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-nitroaniline?
The canonical SMILES of 3-Bromo-2-nitroaniline is C1=CC(=C(C(=C1)Br)[N+](=O)[O-])N.
What is the CAS number of 3-Bromo-2-nitroaniline?
The CAS number of 3-Bromo-2-nitroaniline is 7138-15-0.
What is the European Community (EC) number of 3-Bromo-2-nitroaniline?
The European Community (EC) number of 3-Bromo-2-nitroaniline is 810-100-3.
Is 3-Bromo-2-nitroaniline considered as a canonical compound?
Yes, 3-Bromo-2-nitroaniline is considered as a canonical compound.