What is the molecular formula of 3-Bromo-1H-indole?
The molecular formula of 3-Bromo-1H-indole is C8H6BrN.
What is the molecular weight of 3-Bromo-1H-indole?
The molecular weight of 3-Bromo-1H-indole is 196.04 g/mol.
What is the IUPAC name of 3-Bromo-1H-indole?
The IUPAC name of 3-Bromo-1H-indole is 3-bromo-1H-indole.
What is the InChI of 3-Bromo-1H-indole?
The InChI of 3-Bromo-1H-indole is InChI=1S/C8H6BrN/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5,10H.
What is the InChIKey of 3-Bromo-1H-indole?
The InChIKey of 3-Bromo-1H-indole is YHIWBVHIGCRVLE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-1H-indole?
The canonical SMILES of 3-Bromo-1H-indole is C1=CC=C2C(=C1)C(=CN2)Br.
What is the CAS number of 3-Bromo-1H-indole?
The CAS number of 3-Bromo-1H-indole is 1484-27-1.
How many hydrogen bond donor counts does 3-Bromo-1H-indole have?
3-Bromo-1H-indole has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-1H-indole have?
3-Bromo-1H-indole has 0 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Bromo-1H-indole have?
3-Bromo-1H-indole has 0 rotatable bond counts.