What is the molecular formula of 3-Bromo-1H-indazole?
The molecular formula of 3-Bromo-1H-indazole is C7H5BrN2.
What is the molecular weight of 3-Bromo-1H-indazole?
The molecular weight of 3-Bromo-1H-indazole is 197.03 g/mol.
What is the IUPAC name of 3-Bromo-1H-indazole?
The IUPAC name of 3-Bromo-1H-indazole is 3-bromo-2H-indazole.
What is the InChI of 3-Bromo-1H-indazole?
The InChI of 3-Bromo-1H-indazole is InChI=1S/C7H5BrN2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10).
What is the InChIKey of 3-Bromo-1H-indazole?
The InChIKey of 3-Bromo-1H-indazole is HTKXRTUKPXEALT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-1H-indazole?
The canonical SMILES of 3-Bromo-1H-indazole is C1=CC2=C(NN=C2C=C1)Br.
What is the CAS number of 3-Bromo-1H-indazole?
The CAS number of 3-Bromo-1H-indazole is 40598-94-5.
What is the European Community (EC) number of 3-Bromo-1H-indazole?
The European Community (EC) number of 3-Bromo-1H-indazole is 687-051-8.
What is the ChEMBL ID of 3-Bromo-1H-indazole?
The ChEMBL ID of 3-Bromo-1H-indazole is CHEMBL1482381.
Is 3-Bromo-1H-indazole a canonicalized compound?
Yes, 3-Bromo-1H-indazole is a canonicalized compound according to PubChem.