What is the PubChem CID of 3-Benzoylbenzylbromide?
The PubChem CID of 3-Benzoylbenzylbromide is 89586.
What is the molecular formula of 3-Benzoylbenzylbromide?
The molecular formula of 3-Benzoylbenzylbromide is C14H11BrO.
What is the molecular weight of 3-Benzoylbenzylbromide?
The molecular weight of 3-Benzoylbenzylbromide is 275.14 g/mol.
What is the IUPAC name of 3-Benzoylbenzylbromide?
The IUPAC name of 3-Benzoylbenzylbromide is [3-(bromomethyl)phenyl]-phenylmethanone.
What is the InChI of 3-Benzoylbenzylbromide?
The InChI of 3-Benzoylbenzylbromide is InChI=1S/C14H11BrO/c15-10-11-5-4-8-13(9-11)14(16)12-6-2-1-3-7-12/h1-9H,10H2.
What is the InChIKey of 3-Benzoylbenzylbromide?
The InChIKey of 3-Benzoylbenzylbromide is SZJQXQICJDHRJE-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Benzoylbenzylbromide?
The Canonical SMILES of 3-Benzoylbenzylbromide is C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)CBr.
What is the CAS number of 3-Benzoylbenzylbromide?
The CAS number of 3-Benzoylbenzylbromide is 22071-24-5.
What is the European Community (EC) Number of 3-Benzoylbenzylbromide?
The European Community (EC) Number of 3-Benzoylbenzylbromide is 244-761-9.
Is 3-Benzoylbenzylbromide a canonicalized compound?
Yes, 3-Benzoylbenzylbromide is a canonicalized compound according to PubChem.