What is the molecular formula of 3-Aminostyrene?
The molecular formula of 3-Aminostyrene is C8H9N.
What is the molecular weight of 3-Aminostyrene?
The molecular weight of 3-Aminostyrene is 119.16 g/mol.
What is the IUPAC Name of 3-Aminostyrene?
The IUPAC Name of 3-Aminostyrene is 3-ethenylaniline.
What is the InChI of 3-Aminostyrene?
The InChI of 3-Aminostyrene is InChI=1S/C8H9N/c1-2-7-4-3-5-8(9)6-7/h2-6H,1,9H2.
What is the InChIKey of 3-Aminostyrene?
The InChIKey of 3-Aminostyrene is IFSSSYDVRQSDSG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Aminostyrene?
The canonical SMILES of 3-Aminostyrene is C=CC1=CC(=CC=C1)N.
What is the CAS number of 3-Aminostyrene?
The CAS number of 3-Aminostyrene is 15411-43-5.
What is the European Community (EC) number of 3-Aminostyrene?
The European Community (EC) number of 3-Aminostyrene is 626-660-5.
What is the XLogP3 of 3-Aminostyrene?
The XLogP3 of 3-Aminostyrene is 1.8.
Is 3-Aminostyrene a canonicalized compound?
Yes, 3-Aminostyrene is a canonicalized compound according to PubChem.