What is the molecular formula of 3-Aminoquinoline?
The molecular formula of 3-Aminoquinoline is C9H8N2.
When was 3-Aminoquinoline created and last modified?
3-Aminoquinoline was created on 2005-03-26 and last modified on 2023-12-30.
What is the IUPAC Name of 3-Aminoquinoline?
The IUPAC Name of 3-Aminoquinoline is quinolin-3-amine.
What is the Canonical SMILES representation of 3-Aminoquinoline?
The Canonical SMILES representation of 3-Aminoquinoline is C1=CC=C2C(=C1)C=C(C=N2)N.
What is the molecular weight of 3-Aminoquinoline?
The molecular weight of 3-Aminoquinoline is 144.17 g/mol.
What is the InChIKey of 3-Aminoquinoline?
The InChIKey of 3-Aminoquinoline is SVNCRRZKBNSMIV-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3-Aminoquinoline have?
3-Aminoquinoline has 1 hydrogen bond donor count.
What is the heavy atom count in 3-Aminoquinoline?
The heavy atom count in 3-Aminoquinoline is 11.
How many covalently-bonded unit counts are there in 3-Aminoquinoline?
There is 1 covalently-bonded unit count in 3-Aminoquinoline.
What is the topological polar surface area of 3-Aminoquinoline?
The topological polar surface area of 3-Aminoquinoline is 38.9 Å2.