What is the molecular formula of 3-Amino-2-bromopyridine?
The molecular formula of 3-Amino-2-bromopyridine is C5H5BrN2.
What is the molecular weight of 3-Amino-2-bromopyridine?
The molecular weight of 3-Amino-2-bromopyridine is 173.01 g/mol.
What is the IUPAC name of 3-Amino-2-bromopyridine?
The IUPAC name of 3-Amino-2-bromopyridine is 2-bromopyridin-3-amine.
What is the InChI of 3-Amino-2-bromopyridine?
The InChI of 3-Amino-2-bromopyridine is InChI=1S/C5H5BrN2/c6-5-4(7)2-1-3-8-5/h1-3H,7H2.
What is the InChIKey of 3-Amino-2-bromopyridine?
The InChIKey of 3-Amino-2-bromopyridine is HKDVVTLISGIPFE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Amino-2-bromopyridine?
The canonical SMILES of 3-Amino-2-bromopyridine is C1=CC(=C(N=C1)Br)N.
What is the CAS number of 3-Amino-2-bromopyridine?
The CAS number of 3-Amino-2-bromopyridine is 39856-58-1.
What is the EC number of 3-Amino-2-bromopyridine?
The EC number of 3-Amino-2-bromopyridine is 626-782-9.
Is 3-Amino-2-bromopyridine a canonicalized compound?
Yes, 3-Amino-2-bromopyridine is a canonicalized compound.