What is the molecular formula of 3-Amino-2,4-Dibromopyridine?
The molecular formula of 3-Amino-2,4-Dibromopyridine is C5H4Br2N2.
What are the synonyms of 3-Amino-2,4-Dibromopyridine?
The synonyms of 3-Amino-2,4-Dibromopyridine are 2,4-Dibromopyridin-3-amine, 102249-45-6, 3-Amino-2,4-dibromopyridine, 2,4-dibromo-3-aminopyridine, 3-Pyridinamine, 2,4-dibromo-.
What is the molecular weight of 3-Amino-2,4-Dibromopyridine?
The molecular weight of 3-Amino-2,4-Dibromopyridine is 251.91 g/mol.
What is the IUPAC name of 3-Amino-2,4-Dibromopyridine?
The IUPAC name of 3-Amino-2,4-Dibromopyridine is 2,4-dibromopyridin-3-amine.
What is the InChI of 3-Amino-2,4-Dibromopyridine?
The InChI of 3-Amino-2,4-Dibromopyridine is InChI=1S/C5H4Br2N2/c6-3-1-2-9-5(7)4(3)8/h1-2H,8H2.
What is the InChIKey of 3-Amino-2,4-Dibromopyridine?
The InChIKey of 3-Amino-2,4-Dibromopyridine is FCDIANNJBNOJDX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Amino-2,4-Dibromopyridine?
The canonical SMILES of 3-Amino-2,4-Dibromopyridine is C1=CN=C(C(=C1Br)N)Br.
What is the CAS number of 3-Amino-2,4-Dibromopyridine?
The CAS number of 3-Amino-2,4-Dibromopyridine is 102249-45-6.
Is 3-Amino-2,4-Dibromopyridine a canonicalized compound?
Yes, 3-Amino-2,4-Dibromopyridine is a canonicalized compound.
※ Please kindly note that our products are for research use only.