What is the molecular formula of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The molecular formula is C9H11NO5S.
What are the synonyms for 3-(Acetylthio)propionic acid N-succinimidyl ester?
The synonyms are N-Succinimidyl-S-acetylthiopropionate, 2,5-DIOXOPYRROLIDIN-1-YL 3-(ACETYLTHIO)PROPANOATE, and (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate.
What is the molecular weight of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The molecular weight is 245.25 g/mol.
When was 3-(Acetylthio)propionic acid N-succinimidyl ester created?
It was created on September 13, 2005.
When was 3-(Acetylthio)propionic acid N-succinimidyl ester last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The IUPAC name is "(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate".
What is the InChI of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The InChI is "InChI=1S/C9H11NO5S/c1-6(11)16-5-4-9(14)15-10-7(12)2-3-8(10)13/h2-5H2,1H3".
What is the InChIKey of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The InChIKey is "ZRTJVRDXVSDKPX-UHFFFAOYSA-N".
What is the canonical SMILES of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The canonical SMILES is "CC(=O)SCCC(=O)ON1C(=O)CCC1=O".
What is the hydrogen bond acceptor count of 3-(Acetylthio)propionic acid N-succinimidyl ester?
The hydrogen bond acceptor count is 6.
※ Please kindly note that our products are for research use only.