What is the molecular formula of Dimidium bromide?
The molecular formula of Dimidium bromide is C20H18BrN3.
What are some synonyms for Dimidium bromide?
Some synonyms for Dimidium bromide are Trypadine, 3,8-Diamino-5-methyl-6-phenylphenanthridinium bromide, and Phenanthridinium compound 1553.
What is the molecular weight of Dimidium bromide?
The molecular weight of Dimidium bromide is 380.3 g/mol.
What is the parent compound of Dimidium bromide?
The parent compound of Dimidium bromide is 3,8-Diamino-5-methyl-6-phenylphenanthridinium.
What is the IUPAC name of Dimidium bromide?
The IUPAC name of Dimidium bromide is 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine; bromide.
What is the InChI of Dimidium bromide?
The InChI of Dimidium bromide is InChI=1S/C20H17N3.BrH/c1-23-19-12-15(22)8-10-17(19)16-9-7-14(21)11-18(16)20(23)13-5-3-2-4-6-13;/h2-12,22H,21H2,1H3;1H.
What is the InChIKey of Dimidium bromide?
The InChIKey of Dimidium bromide is MQOKYEROIFEEBH-UHFFFAOYSA-N.
What is the CAS number of Dimidium bromide?
The CAS number of Dimidium bromide is 518-67-2.
What is the hydrogen bond donor count of Dimidium bromide?
The hydrogen bond donor count of Dimidium bromide is 2.
What is the hydrogen bond acceptor count of Dimidium bromide?
The hydrogen bond acceptor count of Dimidium bromide is 3.