What is the molecular formula of 3,6-Dibromo pyridazine?
The molecular formula of 3,6-Dibromo pyridazine is C4H2Br2N2.
What is the molecular weight of 3,6-Dibromo pyridazine?
The molecular weight of 3,6-Dibromo pyridazine is 237.88 g/mol.
What is the IUPAC name of 3,6-Dibromo pyridazine?
The IUPAC name of 3,6-Dibromo pyridazine is 3,6-dibromopyridazine.
What is the InChI of 3,6-Dibromo pyridazine?
The InChI of 3,6-Dibromo pyridazine is InChI=1S/C4H2Br2N2/c5-3-1-2-4(6)8-7-3/h1-2H.
What is the InChIKey of 3,6-Dibromo pyridazine?
The InChIKey of 3,6-Dibromo pyridazine is VQAFMTSSCUETHA-UHFFFAOYSA-N.
What is the canonical SMILES of 3,6-Dibromo pyridazine?
The canonical SMILES of 3,6-Dibromo pyridazine is C1=CC(=NN=C1Br)Br.
What is the CAS number of 3,6-Dibromo pyridazine?
The CAS number of 3,6-Dibromo pyridazine is 17973-86-3.
What is the European Community (EC) number of 3,6-Dibromo pyridazine?
The European Community (EC) number of 3,6-Dibromo pyridazine is 687-847-5.
What is the DSSTox Substance ID of 3,6-Dibromo pyridazine?
The DSSTox Substance ID of 3,6-Dibromo pyridazine is DTXSID70290072.
Is 3,6-Dibromo pyridazine a canonicalized compound?
Yes, 3,6-Dibromo pyridazine is canonicalized according to PubChem.