What is the molecular formula of 3,5-Dinitropyridine?
The molecular formula of 3,5-Dinitropyridine is C5H3N3O4.
What is the molecular weight of 3,5-Dinitropyridine?
The molecular weight of 3,5-Dinitropyridine is 169.10 g/mol.
What is the IUPAC name of 3,5-Dinitropyridine?
The IUPAC name of 3,5-Dinitropyridine is 3,5-dinitropyridine.
What is the InChI of 3,5-Dinitropyridine?
The InChI of 3,5-Dinitropyridine is InChI=1S/C5H3N3O4/c9-7(10)4-1-5(8(11)12)3-6-2-4/h1-3H.
What is the InChIKey of 3,5-Dinitropyridine?
The InChIKey of 3,5-Dinitropyridine is RFSIFTKIXZLPHR-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dinitropyridine?
The canonical SMILES of 3,5-Dinitropyridine is C1=C(C=NC=C1[N+](=O)[O-])[N+](=O)[O-].
What is the CAS number of 3,5-Dinitropyridine?
The CAS number of 3,5-Dinitropyridine is 940-06-7.
What is the XLogP3-AA value of 3,5-Dinitropyridine?
The XLogP3-AA value of 3,5-Dinitropyridine is 0.5.
What is the hydrogen bond acceptor count of 3,5-Dinitropyridine?
The hydrogen bond acceptor count of 3,5-Dinitropyridine is 5.
What is the topological polar surface area of 3,5-Dinitropyridine?
The topological polar surface area of 3,5-Dinitropyridine is 105Ų.