What is the molecular formula of 3,5-Diiodothyroacetic acid?
The molecular formula of 3,5-Diiodothyroacetic acid is C14H10I2O4.
What is the molecular weight of 3,5-Diiodothyroacetic acid?
The molecular weight of 3,5-Diiodothyroacetic acid is 496.03 g/mol.
What are the synonyms of 3,5-Diiodothyroacetic acid?
The synonyms of 3,5-Diiodothyroacetic acid are 1155-40-4, 4-(4-Hydroxyphenoxy)-3,5-diiodophenylacetic acid, 2-(4-(4-hydroxyphenoxy)-3,5-diiodophenyl)acetic acid, and 3,5-Diiodo Thyroacetic Acid.
When was 3,5-Diiodothyroacetic acid created?
3,5-Diiodothyroacetic acid was created on March 26, 2005.
When was 3,5-Diiodothyroacetic acid last modified?
3,5-Diiodothyroacetic acid was last modified on December 30, 2023.
What is the IUPAC name of 3,5-Diiodothyroacetic acid?
The IUPAC name of 3,5-Diiodothyroacetic acid is 2-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]acetic acid.
What is the InChI of 3,5-Diiodothyroacetic acid?
The InChI of 3,5-Diiodothyroacetic acid is InChI=1S/C14H10I2O4/c15-11-5-8(7-13(18)19)6-12(16)14(11)20-10-3-1-9(17)2-4-10/h1-6,17H,7H2,(H,18,19).
What is the InChIKey of 3,5-Diiodothyroacetic acid?
The InChIKey of 3,5-Diiodothyroacetic acid is KKJBNMLZBHFYAE-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Diiodothyroacetic acid?
The canonical SMILES of 3,5-Diiodothyroacetic acid is C1=CC(=CC=C1O)OC2=C(C=C(C=C2I)CC(=O)O)I.
What is the CAS number of 3,5-Diiodothyroacetic acid?
The CAS number of 3,5-Diiodothyroacetic acid is 1155-40-4.
※ Please kindly note that our products are for research use only.