What is the PubChem CID of 3,5-Difluorothiophenol?
The PubChem CID of 3,5-Difluorothiophenol is 2758361.
What is the molecular formula of 3,5-Difluorothiophenol?
The molecular formula of 3,5-Difluorothiophenol is C6H4F2S.
What is the molecular weight of 3,5-Difluorothiophenol?
The molecular weight of 3,5-Difluorothiophenol is 146.16 g/mol.
What is the IUPAC name of 3,5-Difluorothiophenol?
The IUPAC name of 3,5-Difluorothiophenol is 3,5-difluorobenzenethiol.
What is the InChI of 3,5-Difluorothiophenol?
The InChI of 3,5-Difluorothiophenol is InChI=1S/C6H4F2S/c7-4-1-5(8)3-6(9)2-4/h1-3,9H.
What is the InChIKey of 3,5-Difluorothiophenol?
The InChIKey of 3,5-Difluorothiophenol is LFYVNHDFVIPZHV-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluorothiophenol?
The canonical SMILES of 3,5-Difluorothiophenol is C1=C(C=C(C=C1F)S)F.
What is the CAS number of 3,5-Difluorothiophenol?
The CAS number of 3,5-Difluorothiophenol is 99389-26-1.
What is the EC number of 3,5-Difluorothiophenol?
The EC number of 3,5-Difluorothiophenol is 675-532-5.
What is the molecular weight and XLogP3-AA value of 3,5-Difluorothiophenol?
The molecular weight of 3,5-Difluorothiophenol is 146.16 g/mol, and the XLogP3-AA value is 2.3.