What is the PubChem CID for 3,5-Difluorobenzaldehyde?
The PubChem CID for 3,5-Difluorobenzaldehyde is 588160.
What is the molecular formula of 3,5-Difluorobenzaldehyde?
The molecular formula of 3,5-Difluorobenzaldehyde is C7H4F2O.
What is the IUPAC Name of 3,5-Difluorobenzaldehyde?
The IUPAC Name of 3,5-Difluorobenzaldehyde is 3,5-difluorobenzaldehyde.
What is the InChI of 3,5-Difluorobenzaldehyde?
The InChI of 3,5-Difluorobenzaldehyde is InChI=1S/C7H4F2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H.
What is the InChIKey of 3,5-Difluorobenzaldehyde?
The InChIKey of 3,5-Difluorobenzaldehyde is ASOFZHSTJHGQDT-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluorobenzaldehyde?
The canonical SMILES of 3,5-Difluorobenzaldehyde is C1=C(C=C(C=C1F)F)C=O.
What is the CAS number of 3,5-Difluorobenzaldehyde?
The CAS number of 3,5-Difluorobenzaldehyde is 32085-88-4.
What is the molecular weight of 3,5-Difluorobenzaldehyde?
The molecular weight of 3,5-Difluorobenzaldehyde is 142.10 g/mol.
How many hydrogen bond acceptors are there in 3,5-Difluorobenzaldehyde?
There are 3 hydrogen bond acceptors in 3,5-Difluorobenzaldehyde.
Is 3,5-Difluorobenzaldehyde a canonicalized compound?
Yes, 3,5-Difluorobenzaldehyde is a canonicalized compound.