What is the molecular formula of 3,5-Difluoroanisole?
The molecular formula of 3,5-Difluoroanisole is C7H6F2O.
What is the molecular weight of 3,5-Difluoroanisole?
The molecular weight of 3,5-Difluoroanisole is 144.12 g/mol.
What is the IUPAC name of 3,5-Difluoroanisole?
The IUPAC name of 3,5-Difluoroanisole is 1,3-difluoro-5-methoxybenzene.
What is the InChI of 3,5-Difluoroanisole?
The InChI of 3,5-Difluoroanisole is InChI=1S/C7H6F2O/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3.
What is the InChIKey of 3,5-Difluoroanisole?
The InChIKey of 3,5-Difluoroanisole is OTGQPYSISUUHAF-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluoroanisole?
The canonical SMILES of 3,5-Difluoroanisole is COC1=CC(=CC(=C1)F)F.
What is the CAS number of 3,5-Difluoroanisole?
The CAS number of 3,5-Difluoroanisole is 93343-10-3.
What is the XLogP3 value of 3,5-Difluoroanisole?
The XLogP3 value of 3,5-Difluoroanisole is 2.7.
How many hydrogen bond acceptors are there in 3,5-Difluoroanisole?
There are 3 hydrogen bond acceptors in 3,5-Difluoroanisole.
How many rotatable bonds are there in 3,5-Difluoroanisole?
There is 1 rotatable bond in 3,5-Difluoroanisole.