What is the molecular formula of 3,5-Difluoroaniline?
The molecular formula of 3,5-Difluoroaniline is C6H5F2N.
What is the molecular weight of 3,5-Difluoroaniline?
The molecular weight of 3,5-Difluoroaniline is 129.11 g/mol.
What is the IUPAC name of 3,5-Difluoroaniline?
The IUPAC name of 3,5-Difluoroaniline is 3,5-difluoroaniline.
What is the InChI of 3,5-Difluoroaniline?
The InChI of 3,5-Difluoroaniline is InChI=1S/C6H5F2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2.
What is the InChIKey of 3,5-Difluoroaniline?
The InChIKey of 3,5-Difluoroaniline is KQOIBXZRCYFZSO-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluoroaniline?
The canonical SMILES of 3,5-Difluoroaniline is C1=C(C=C(C=C1F)F)N.
What is the CAS number of 3,5-Difluoroaniline?
The CAS number of 3,5-Difluoroaniline is 372-39-4.
What is the European Community (EC) number of 3,5-Difluoroaniline?
The European Community (EC) number of 3,5-Difluoroaniline is 206-752-8.
What is the UNII of 3,5-Difluoroaniline?
The UNII of 3,5-Difluoroaniline is 93F28C8C0X.
Is 3,5-Difluoroaniline a canonicalized compound?
Yes, 3,5-Difluoroaniline is a canonicalized compound.