What is the molecular formula of 3,5-Difluoro-L-tyrosine?
The molecular formula of 3,5-Difluoro-L-tyrosine is C9H9F2NO3.
What is the molecular weight of 3,5-Difluoro-L-tyrosine?
The molecular weight of 3,5-Difluoro-L-tyrosine is 217.17 g/mol.
What is the IUPAC name of 3,5-Difluoro-L-tyrosine?
The IUPAC name of 3,5-Difluoro-L-tyrosine is (2S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid.
What is the Canonical SMILES of 3,5-Difluoro-L-tyrosine?
The Canonical SMILES of 3,5-Difluoro-L-tyrosine is C1=C(C=C(C(=C1F)O)F)CC(C(=O)O)N.
How many hydrogen bond donor counts does 3,5-Difluoro-L-tyrosine have?
3,5-Difluoro-L-tyrosine has 3 hydrogen bond donor counts.
What is the exact mass of 3,5-Difluoro-L-tyrosine?
The exact mass of 3,5-Difluoro-L-tyrosine is 217.05504947 g/mol.
How many rotatable bond counts does 3,5-Difluoro-L-tyrosine have?
3,5-Difluoro-L-tyrosine has 3 rotatable bond counts.
Is 3,5-Difluoro-L-tyrosine a canonicalized compound?
Yes, 3,5-Difluoro-L-tyrosine is a canonicalized compound.
What is the topological polar surface area of 3,5-Difluoro-L-tyrosine?
The topological polar surface area of 3,5-Difluoro-L-tyrosine is 83.6 Ų.
How many defined atom stereocenter counts does 3,5-Difluoro-L-tyrosine have?
3,5-Difluoro-L-tyrosine has 1 defined atom stereocenter count.