What is the molecular formula of 3,5-Dibromopiperidine?
The molecular formula of 3,5-Dibromopiperidine is C5H9Br2N.
What is the molecular weight of 3,5-Dibromopiperidine?
The molecular weight of 3,5-Dibromopiperidine is 242.94 g/mol.
What is the IUPAC name of 3,5-Dibromopiperidine?
The IUPAC name of 3,5-Dibromopiperidine is 3,5-dibromopiperidine.
What is the InChI of 3,5-Dibromopiperidine?
The InChI of 3,5-Dibromopiperidine is InChI=1S/C5H9Br2N/c6-4-1-5(7)3-8-2-4/h4-5,8H,1-3H2.
What is the InChIKey of 3,5-Dibromopiperidine?
The InChIKey of 3,5-Dibromopiperidine is AQKWBBJYFVHMRO-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromopiperidine?
The canonical SMILES of 3,5-Dibromopiperidine is C1C(CNCC1Br)Br.
What is the CAS number of 3,5-Dibromopiperidine?
The CAS number of 3,5-Dibromopiperidine is 916792-57-9.
What is the XLogP3-AA value of 3,5-Dibromopiperidine?
The XLogP3-AA value of 3,5-Dibromopiperidine is 1.6.
How many hydrogen bond donor counts does 3,5-Dibromopiperidine have?
3,5-Dibromopiperidine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3,5-Dibromopiperidine have?
3,5-Dibromopiperidine has 1 hydrogen bond acceptor count.