What is the molecular formula of 3,5-dibromoisonicotinaldehyde?
The molecular formula of 3,5-dibromoisonicotinaldehyde is C6H3Br2NO.
What are the synonyms for 3,5-dibromoisonicotinaldehyde?
The synonyms for 3,5-dibromoisonicotinaldehyde are 70201-42-2, 3,5-dibromopyridine-4-carbaldehyde, 3,5-dibromopyridine-4-carboxaldehyde, and 3,5-Dibromo-4-pyridinecarboxaldehyde.
What is the molecular weight of 3,5-dibromoisonicotinaldehyde?
The molecular weight of 3,5-dibromoisonicotinaldehyde is 264.90 g/mol.
When was 3,5-dibromoisonicotinaldehyde created and last modified?
3,5-dibromoisonicotinaldehyde was created on July 19, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 3,5-dibromoisonicotinaldehyde?
The IUPAC name of 3,5-dibromoisonicotinaldehyde is 3,5-dibromopyridine-4-carbaldehyde.
What is the InChI of 3,5-dibromoisonicotinaldehyde?
The InChI of 3,5-dibromoisonicotinaldehyde is InChI=1S/C6H3Br2NO/c7-5-1-9-2-6(8)4(5)3-10/h1-3H.
What is the InChIKey of 3,5-dibromoisonicotinaldehyde?
The InChIKey of 3,5-dibromoisonicotinaldehyde is WPBYVMDYYFWYAY-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-dibromoisonicotinaldehyde?
The canonical SMILES of 3,5-dibromoisonicotinaldehyde is C1=C(C(=C(C=N1)Br)C=O)Br.
What is the CAS number of 3,5-dibromoisonicotinaldehyde?
The CAS number of 3,5-dibromoisonicotinaldehyde is 70201-42-2.
What is the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of 3,5-dibromoisonicotinaldehyde?
The molecular weight of 3,5-dibromoisonicotinaldehyde is 264.90 g/mol. The XLogP3-AA value of 3,5-dibromoisonicotinaldehyde is 1.7. The hydrogen bond donor count of 3,5-dibromoisonicotinaldehyde is 0. The hydrogen bond acceptor count of 3,5-dibromoisonicotinaldehyde is 2. The rotatable bond count of 3,5-dibromoisonicotinaldehyde is 1.
※ Please kindly note that our products are for research use only.