What is the chemical formula of 3,5-Dibromochlorobenzene?
The chemical formula of 3,5-Dibromochlorobenzene is C6H3Br2Cl.
What is the molecular weight of 3,5-Dibromochlorobenzene?
The molecular weight of 3,5-Dibromochlorobenzene is 270.35 g/mol.
What is the IUPAC name of 3,5-Dibromochlorobenzene?
The IUPAC name of 3,5-Dibromochlorobenzene is 1,3-dibromo-5-chlorobenzene.
What is the InChI of 3,5-Dibromochlorobenzene?
The InChI of 3,5-Dibromochlorobenzene is InChI=1S/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H.
What is the InChIKey of 3,5-Dibromochlorobenzene?
The InChIKey of 3,5-Dibromochlorobenzene is FNKCOUREFBNNHG-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromochlorobenzene?
The canonical SMILES of 3,5-Dibromochlorobenzene is C1=C(C=C(C=C1Br)Br)Cl.
What is the CAS number of 3,5-Dibromochlorobenzene?
The CAS number of 3,5-Dibromochlorobenzene is 14862-52-3.
What is the EC number of 3,5-Dibromochlorobenzene?
The EC number of 3,5-Dibromochlorobenzene is 627-184-0.
Is 3,5-Dibromochlorobenzene a canonicalized compound?
Yes, 3,5-Dibromochlorobenzene is a canonicalized compound.