What is the molecular formula of 3,5-dibromo-L-tyrosine?
The molecular formula of 3,5-dibromo-L-tyrosine is C9H9Br2NO3.
What is the molecular weight of 3,5-dibromo-L-tyrosine?
The molecular weight of 3,5-dibromo-L-tyrosine is 338.98 g/mol.
What is the IUPAC name of 3,5-dibromo-L-tyrosine?
The IUPAC name of 3,5-dibromo-L-tyrosine is (2S)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid.
What is the InChI of 3,5-dibromo-L-tyrosine?
The InChI of 3,5-dibromo-L-tyrosine is InChI=1S/C9H9Br2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1.
What is the InChIKey of 3,5-dibromo-L-tyrosine?
The InChIKey of 3,5-dibromo-L-tyrosine is COESHZUDRKCEPA-ZETCQYMHSA-N.
What is the canonical SMILES of 3,5-dibromo-L-tyrosine?
The canonical SMILES of 3,5-dibromo-L-tyrosine is C1=C(C=C(C(=C1Br)O)Br)CC(C(=O)O)N.
How many hydrogen bond donor counts are there in 3,5-dibromo-L-tyrosine?
There are 3 hydrogen bond donor counts in 3,5-dibromo-L-tyrosine.
How many hydrogen bond acceptor counts are there in 3,5-dibromo-L-tyrosine?
There are 4 hydrogen bond acceptor counts in 3,5-dibromo-L-tyrosine.
How many rotatable bond counts are there in 3,5-dibromo-L-tyrosine?
There are 3 rotatable bond counts in 3,5-dibromo-L-tyrosine.
What is the topological polar surface area (TPSA) of 3,5-dibromo-L-tyrosine?
The topological polar surface area (TPSA) of 3,5-dibromo-L-tyrosine is 83.6Ų.