What is the molecular formula of 3,5-Dibromo-2-hydroxy-4-picoline?
The molecular formula of 3,5-Dibromo-2-hydroxy-4-picoline is C6H5Br2NO.
What are the synonyms for 3,5-Dibromo-2-hydroxy-4-picoline?
The synonyms for 3,5-Dibromo-2-hydroxy-4-picoline include 89581-53-3, 3,5-Dibromo-2-hydroxy-4-methylpyridine, 3,5-dibromo-4-methyl-1H-pyridin-2-one, and 3,5-dibromo-4-methylpyridin-2-ol, among others.
What is the molecular weight of 3,5-Dibromo-2-hydroxy-4-picoline?
The molecular weight of 3,5-Dibromo-2-hydroxy-4-picoline is 266.92 g/mol.
What is the IUPAC name of 3,5-Dibromo-2-hydroxy-4-picoline?
The IUPAC name of 3,5-Dibromo-2-hydroxy-4-picoline is 3,5-dibromo-4-methyl-1H-pyridin-2-one.
What is the InChI of 3,5-Dibromo-2-hydroxy-4-picoline?
The InChI of 3,5-Dibromo-2-hydroxy-4-picoline is InChI=1S/C6H5Br2NO/c1-3-4(7)2-9-6(10)5(3)8/h2H,1H3,(H,9,10).
What is the InChIKey of 3,5-Dibromo-2-hydroxy-4-picoline?
The InChIKey of 3,5-Dibromo-2-hydroxy-4-picoline is LZRVNGJBQXHGIP-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromo-2-hydroxy-4-picoline?
The canonical SMILES of 3,5-Dibromo-2-hydroxy-4-picoline is CC1=C(C(=O)NC=C1Br)Br.
What is the XLogP3-AA value of 3,5-Dibromo-2-hydroxy-4-picoline?
The XLogP3-AA value of 3,5-Dibromo-2-hydroxy-4-picoline is 1.4.
How many hydrogen bond donor counts does 3,5-Dibromo-2-hydroxy-4-picoline have?
3,5-Dibromo-2-hydroxy-4-picoline has 1 hydrogen bond donor count.
How many rotatable bond counts does 3,5-Dibromo-2-hydroxy-4-picoline have?
3,5-Dibromo-2-hydroxy-4-picoline has 0 rotatable bond counts.
※ Please kindly note that our products are for research use only.