What is the molecular formula of 3,5-diaminosalicylic acid?
The molecular formula of 3,5-diaminosalicylic acid is C7H8N2O3.
What are the synonyms for 3,5-diaminosalicylic acid?
The synonyms for 3,5-diaminosalicylic acid are 3,5-diamino-2-hydroxybenzoic acid, 112725-89-0, Benzoic acid, 3,5-diamino-2-hydroxy-, and 3,5-diamino-2-hydroxy-benzoic acid.
What is the molecular weight of 3,5-diaminosalicylic acid?
The molecular weight of 3,5-diaminosalicylic acid is 168.15 g/mol.
When was 3,5-diaminosalicylic acid created?
3,5-diaminosalicylic acid was created on February 12, 2007.
When was 3,5-diaminosalicylic acid last modified?
3,5-diaminosalicylic acid was last modified on October 21, 2023.
What is the IUPAC name of 3,5-diaminosalicylic acid?
The IUPAC name of 3,5-diaminosalicylic acid is 3,5-diamino-2-hydroxybenzoic acid.
What is the InChI of 3,5-diaminosalicylic acid?
The InChI of 3,5-diaminosalicylic acid is InChI=1S/C7H8N2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,8-9H2,(H,11,12).
What is the InChIKey of 3,5-diaminosalicylic acid?
The InChIKey of 3,5-diaminosalicylic acid is HQURVGSRQBOZEX-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-diaminosalicylic acid?
The canonical SMILES of 3,5-diaminosalicylic acid is C1=C(C=C(C(=C1C(=O)O)O)N)N.
What is the CAS number of 3,5-diaminosalicylic acid?
The CAS number of 3,5-diaminosalicylic acid is 112725-89-0.
※ Please kindly note that our products are for research use only.