What is the molecular formula of 3,4-Oxydianiline?
The molecular formula of 3,4-Oxydianiline is C12H12N2O.
What is the molecular weight of 3,4-Oxydianiline?
The molecular weight of 3,4-Oxydianiline is 200.24 g/mol.
What is the IUPAC name of 3,4-Oxydianiline?
The IUPAC name of 3,4-Oxydianiline is 3-(4-aminophenoxy)aniline.
What is the InChI of 3,4-Oxydianiline?
The InChI of 3,4-Oxydianiline is InChI=1S/C12H12N2O/c13-9-4-6-11(7-5-9)15-12-3-1-2-10(14)8-12/h1-8H,13-14H2.
What is the InChIKey of 3,4-Oxydianiline?
The InChIKey of 3,4-Oxydianiline is ZBMISJGHVWNWTE-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,4-Oxydianiline?
The Canonical SMILES of 3,4-Oxydianiline is C1=CC(=CC(=C1)OC2=CC=C(C=C2)N)N.
What is the CAS number of 3,4-Oxydianiline?
The CAS number of 3,4-Oxydianiline is 2657-87-6.
What is the European Community (EC) number of 3,4-Oxydianiline?
The European Community (EC) number of 3,4-Oxydianiline is 220-190-0.
What is the DSSTox Substance ID of 3,4-Oxydianiline?
The DSSTox Substance ID of 3,4-Oxydianiline is DTXSID80181144.
Is 3,4-Oxydianiline a canonicalized compound?
Yes, 3,4-Oxydianiline is a canonicalized compound.