What is the molecular formula of 3,4-Dimethylbenzophenone?
The molecular formula of 3,4-Dimethylbenzophenone is C15H14O.
What is the molecular weight of 3,4-Dimethylbenzophenone?
The molecular weight of 3,4-Dimethylbenzophenone is 210.27 g/mol.
What is the IUPAC name of 3,4-Dimethylbenzophenone?
The IUPAC name of 3,4-Dimethylbenzophenone is (3,4-dimethylphenyl)-phenylmethanone.
What is the InChI of 3,4-Dimethylbenzophenone?
The InChI of 3,4-Dimethylbenzophenone is InChI=1S/C15H14O/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13/h3-10H,1-2H3.
What is the InChIKey of 3,4-Dimethylbenzophenone?
The InChIKey of 3,4-Dimethylbenzophenone is JENOLWCGNVWTJN-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dimethylbenzophenone?
The canonical SMILES of 3,4-Dimethylbenzophenone is CC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)C.
What is the CAS number of 3,4-Dimethylbenzophenone?
The CAS number of 3,4-Dimethylbenzophenone is 2571-39-3.
What is the European Community (EC) Number of 3,4-Dimethylbenzophenone?
The European Community (EC) Number of 3,4-Dimethylbenzophenone is 219-916-9.
What is the DSSTox Substance ID of 3,4-Dimethylbenzophenone?
The DSSTox Substance ID of 3,4-Dimethylbenzophenone is DTXSID90180401.
Is 3,4-Dimethylbenzophenone a canonicalized compound?
Yes, 3,4-Dimethylbenzophenone is a canonicalized compound.