What is the molecular formula of 3,4-Dimethylanisole?
The molecular formula of 3,4-Dimethylanisole is C9H12O.
What is the molecular weight of 3,4-Dimethylanisole?
The molecular weight of 3,4-Dimethylanisole is 136.19 g/mol.
What is the IUPAC name of 3,4-Dimethylanisole?
The IUPAC name of 3,4-Dimethylanisole is 4-methoxy-1,2-dimethylbenzene.
What is the InChI of 3,4-Dimethylanisole?
The InChI of 3,4-Dimethylanisole is InChI=1S/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3.
What is the InChIKey of 3,4-Dimethylanisole?
The InChIKey of 3,4-Dimethylanisole is LVUBSVWMOWKPDJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dimethylanisole?
The canonical SMILES of 3,4-Dimethylanisole is CC1=C(C=C(C=C1)OC)C.
What is the CAS number of 3,4-Dimethylanisole?
The CAS number of 3,4-Dimethylanisole is 4685-47-6.
What is the European Community (EC) number of 3,4-Dimethylanisole?
The European Community (EC) number of 3,4-Dimethylanisole is 225-142-2.
What is the DSSTox Substance ID of 3,4-Dimethylanisole?
The DSSTox Substance ID of 3,4-Dimethylanisole is DTXSID70196964.
Is 3,4-Dimethylanisole a canonicalized compound?
Yes, 3,4-Dimethylanisole is a canonicalized compound.