What is the molecular formula of 3,4-Difluoroiodobenzene?
The molecular formula of 3,4-Difluoroiodobenzene is C6H3F2I.
What is the molecular weight of 3,4-Difluoroiodobenzene?
The molecular weight of 3,4-Difluoroiodobenzene is 239.99 g/mol.
What is the IUPAC name of 3,4-Difluoroiodobenzene?
The IUPAC name of 3,4-Difluoroiodobenzene is 1,2-difluoro-4-iodobenzene.
What is the InChI of 3,4-Difluoroiodobenzene?
The InChI of 3,4-Difluoroiodobenzene is InChI=1S/C6H3F2I/c7-5-2-1-4(9)3-6(5)8/h1-3H.
What is the InChIKey of 3,4-Difluoroiodobenzene?
The InChIKey of 3,4-Difluoroiodobenzene is KSASJELKLBIMSG-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Difluoroiodobenzene?
The canonical SMILES of 3,4-Difluoroiodobenzene is C1=CC(=C(C=C1I)F)F.
What is the CAS number of 3,4-Difluoroiodobenzene?
The CAS number of 3,4-Difluoroiodobenzene is 64248-58-4.
What is the molecular weight of 3,4-Difluoroiodobenzene according to PubChem?
The molecular weight of 3,4-Difluoroiodobenzene according to PubChem is 239.99 g/mol.
What is the XLogP3-AA value of 3,4-Difluoroiodobenzene?
The XLogP3-AA value of 3,4-Difluoroiodobenzene is 2.8.
Is 3,4-Difluoroiodobenzene a canonicalized compound?
Yes, 3,4-Difluoroiodobenzene is a canonicalized compound according to PubChem.