What is the molecular formula of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The molecular formula of 3,4-Dibenzyloxyphenethylamine hydrochloride is C22H24ClNO2.
What is the molecular weight of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The molecular weight of 3,4-Dibenzyloxyphenethylamine hydrochloride is 369.9 g/mol.
What is the IUPAC name of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The IUPAC name of 3,4-Dibenzyloxyphenethylamine hydrochloride is 2-[3,4-bis(phenylmethoxy)phenyl]ethanamine;hydrochloride.
What is the InChI of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The InChI of 3,4-Dibenzyloxyphenethylamine hydrochloride is InChI=1S/C22H23NO2.ClH/c23-14-13-18-11-12-21(24-16-19-7-3-1-4-8-19)22(15-18)25-17-20-9-5-2-6-10-20;/h1-12,15H,13-14,16-17,23H2;1H.
What is the InChIKey of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The InChIKey of 3,4-Dibenzyloxyphenethylamine hydrochloride is KXIZXPRLNNDQKS-UHFFFAOYSA-N.
What is the CAS number of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The CAS number of 3,4-Dibenzyloxyphenethylamine hydrochloride is 1699-56-5.
How many hydrogen bond donor counts does 3,4-Dibenzyloxyphenethylamine hydrochloride have?
3,4-Dibenzyloxyphenethylamine hydrochloride has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,4-Dibenzyloxyphenethylamine hydrochloride have?
3,4-Dibenzyloxyphenethylamine hydrochloride has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3,4-Dibenzyloxyphenethylamine hydrochloride have?
3,4-Dibenzyloxyphenethylamine hydrochloride has 8 rotatable bond counts.
What is the topological polar surface area of 3,4-Dibenzyloxyphenethylamine hydrochloride?
The topological polar surface area of 3,4-Dibenzyloxyphenethylamine hydrochloride is 44.5Ų.
※ Please kindly note that our products are for research use only.