What is the molecular formula of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The molecular formula is C10H13BrClN.
What are the synonyms for 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The synonyms are 3-(4-bromophenyl)pyrrolidine hydrochloride, 1187931-39-0, 3-(4-BROMO-PHENYL)-PYRROLIDINE HYDROCHLORIDE, and 3-(4-bromophenyl)pyrrolidine;hydrochloride.
What is the molecular weight of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The molecular weight is 262.57 g/mol.
What is the parent compound of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The parent compound is CID 53407707 (3-(4-Bromophenyl)pyrrolidine).
What are the component compounds of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The component compounds are CID 313 (Hydrochloric Acid) and CID 53407707 (3-(4-Bromophenyl)pyrrolidine).
When was 3-(4-Bromophenyl)pyrrolidine hydrochloride created?
It was created on October 30, 2011.
What is the IUPAC name of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The IUPAC name is 3-(4-bromophenyl)pyrrolidine;hydrochloride.
What is the InChI of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The InChI is InChI=1S/C10H12BrN.ClH/c11-10-3-1-8(2-4-10)9-5-6-12-7-9;/h1-4,9,12H,5-7H2;1H.
What is the InChIKey of 3-(4-Bromophenyl)pyrrolidine hydrochloride?
The InChIKey is ILDBWPNFCRWOGV-UHFFFAOYSA-N.
Is 3-(4-Bromophenyl)pyrrolidine hydrochloride a canonicalized compound?
Yes, 3-(4-Bromophenyl)pyrrolidine hydrochloride is canonicalized.
※ Please kindly note that our products are for research use only.