What is the PubChem CID of 3,4,5-Tribromopyridine?
PubChem CID 541462.
What is the molecular formula of 3,4,5-Tribromopyridine?
The molecular formula is C5H2Br3N.
What is the molecular weight of 3,4,5-Tribromopyridine?
The molecular weight is 315.79 g/mol.
What is the IUPAC Name of 3,4,5-Tribromopyridine?
The IUPAC Name is 3,4,5-tribromopyridine.
What is the InChI of 3,4,5-Tribromopyridine?
The InChI is InChI=1S/C5H2Br3N/c6-3-1-9-2-4(7)5(3)8/h1-2H.
What is the InChIKey of 3,4,5-Tribromopyridine?
The InChIKey is CWYVUHWKGWQPLP-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,4,5-Tribromopyridine?
The Canonical SMILES is C1=C(C(=C(C=N1)Br)Br)Br.
What is the CAS number of 3,4,5-Tribromopyridine?
The CAS number is 2457-48-9.
What is the European Community (EC) Number of 3,4,5-Tribromopyridine?
The European Community (EC) Number is 641-239-6.
What is the XLogP3-AA value of 3,4,5-Tribromopyridine?
The XLogP3-AA value is 2.9.