What is the molecular formula of the compound with PubChem CID 2776880?
The molecular formula is C9H6Cl2O.
What are the synonyms of the compound with PubChem CID 2776880?
The synonyms are 3598-66-1, 1,3-dichloro-2-(prop-2-yn-1-yloxy)benzene, 3-(2,6-DICHLOROPHENOXY)-1-PROPYNE, 1,3-dichloro-2-prop-2-ynoxybenzene, and 31401,3-Dichloro-2-(prop-2-ynyloxy)benzene.
What is the molecular weight of the compound with PubChem CID 2776880?
The molecular weight is 201.05 g/mol.
What is the IUPAC name of the compound with PubChem CID 2776880?
The IUPAC name is 1,3-dichloro-2-prop-2-ynoxybenzene.
What is the InChI code of the compound with PubChem CID 2776880?
The InChI code is InChI=1S/C9H6Cl2O/c1-2-6-12-9-7(10)4-3-5-8(9)11/h1,3-5H,6H2.
What is the InChIKey of the compound with PubChem CID 2776880?
The InChIKey is HCGOBPUSIBTNRV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound with PubChem CID 2776880?
The canonical SMILES is C#CCOC1=C(C=CC=C1Cl)Cl.
What is the CAS number of the compound with PubChem CID 2776880?
The CAS number is 3598-66-1.
What is the XLogP3 value of the compound with PubChem CID 2776880?
The XLogP3 value is 3.3.
Is the compound with PubChem CID 2776880 canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.