What is the molecular formula of the compound?
The molecular formula is C8H11NO.
What is the molecular weight of the compound?
The molecular weight is 137.18 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 3-(1-aminoethyl)phenol.
What is the InChI of the compound?
The InChI is InChI=1S/C8H11NO/c1-6(9)7-3-2-4-8(10)5-7/h2-6,10H,9H2,1H3.
What is the InChIKey of the compound?
The InChIKey is WFRNDUQAIZJRPZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC(C1=CC(=CC=C1)O)N.
What is the CAS number of the compound?
The CAS number is 63720-38-7.
What is the European Community (EC) number of the compound?
The European Community (EC) number is 804-066-9.
What is the XLogP3 value of the compound?
The XLogP3 value is 0.9.
Is the compound canonicalized?
Yes, the compound is canonicalized.