What is the molecular formula of 2-Nitroethanol?
The molecular formula of 2-Nitroethanol is C2H5NO3.
What is the molecular weight of 2-Nitroethanol?
The molecular weight of 2-Nitroethanol is 91.07 g/mol.
What is the IUPAC name of 2-Nitroethanol?
The IUPAC name of 2-Nitroethanol is 2-nitroethanol.
What is the InChI of 2-Nitroethanol?
The InChI of 2-Nitroethanol is InChI=1S/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2.
What is the InChIKey of 2-Nitroethanol?
The InChIKey of 2-Nitroethanol is KIPMDPDAFINLIV-UHFFFAOYSA-N.
What is the CAS number of 2-Nitroethanol?
The CAS number of 2-Nitroethanol is 625-48-9.
What is the EC number of 2-Nitroethanol?
The EC number of 2-Nitroethanol is 210-895-1.
What is the XLogP3 value of 2-Nitroethanol?
The XLogP3 value of 2-Nitroethanol is -0.4.
What is the hydrogen bond donor count of 2-Nitroethanol?
The hydrogen bond donor count of 2-Nitroethanol is 1.
What is the hydrogen bond acceptor count of 2-Nitroethanol?
The hydrogen bond acceptor count of 2-Nitroethanol is 3.