What is the PubChem CID of 2-nitrodiphenylamine?
The PubChem CID of 2-nitrodiphenylamine is 8407.
What is the molecular formula of 2-nitrodiphenylamine?
The molecular formula of 2-nitrodiphenylamine is C12H10N2O2.
What is the molecular weight of 2-nitrodiphenylamine?
The molecular weight of 2-nitrodiphenylamine is 214.22 g/mol.
What is the IUPAC name of 2-nitrodiphenylamine?
The IUPAC name of 2-nitrodiphenylamine is 2-nitro-N-phenylaniline.
What is the InChI of 2-nitrodiphenylamine?
The InChI of 2-nitrodiphenylamine is InChI=1S/C12H10N2O2/c15-14(16)12-9-5-4-8-11(12)13-10-6-2-1-3-7-10/h1-9,13H.
What is the InChIKey of 2-nitrodiphenylamine?
The InChIKey of 2-nitrodiphenylamine is RUKISNQKOIKZGT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-nitrodiphenylamine?
The canonical SMILES of 2-nitrodiphenylamine is C1=CC=C(C=C1)NC2=CC=CC=C2[N+](=O)[O-].
What is the CAS number of 2-nitrodiphenylamine?
The CAS number of 2-nitrodiphenylamine is 119-75-5.
What is the UNII of 2-nitrodiphenylamine?
The UNII of 2-nitrodiphenylamine is DT9NA7ZDD8.
Does 2-nitrodiphenylamine have any synonyms?
Yes, 2-nitrodiphenylamine has various synonyms including o-Nitrodiphenylamine and 2-Nitro-N-phenylaniline.