What is the PubChem CID of 2-Naphthyl acrylate?
The PubChem CID of 2-Naphthyl acrylate is 3664250.
What is the molecular formula of 2-Naphthyl acrylate?
The molecular formula of 2-Naphthyl acrylate is C13H10O2.
What is the molecular weight of 2-Naphthyl acrylate?
The molecular weight of 2-Naphthyl acrylate is 198.22 g/mol.
What is the IUPAC name of 2-Naphthyl acrylate?
The IUPAC name of 2-Naphthyl acrylate is naphthalen-2-yl prop-2-enoate.
What is the InChI of 2-Naphthyl acrylate?
The InChI of 2-Naphthyl acrylate is InChI=1S/C13H10O2/c1-2-13(14)15-12-8-7-10-5-3-4-6-11(10)9-12/h2-9H,1H2.
What is the InChIKey of 2-Naphthyl acrylate?
The InChIKey of 2-Naphthyl acrylate is SLVJUZOHXPZVLR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Naphthyl acrylate?
The canonical SMILES of 2-Naphthyl acrylate is C=CC(=O)OC1=CC2=CC=CC=C2C=C1.
What is the CAS number of 2-Naphthyl acrylate?
The CAS number of 2-Naphthyl acrylate is 52684-34-1.
What is the XLogP3 value of 2-Naphthyl acrylate?
The XLogP3 value of 2-Naphthyl acrylate is 3.3.
Is the compound is canonicalized?
Yes, the compound is canonicalized.