What is the molecular formula of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The molecular formula is C8F17SO2N(C2H5)CH2CH2OC(O)CH=CH2.
What is the molecular weight of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The molecular weight is 625.3 g/mol.
What is the IUPAC name of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The IUPAC name is 2-[ethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]ethyl prop-2-enoate.
What is the InChI of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The InChI is InChI=1S/C15H12F17NO4S/c1-3-7(34)37-6-5-33(4-2)38(35,36)15(31,32)13(26,27)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)14(28,29)30/h3H,1,4-6H2,2H3.
What is the InChIKey of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The InChIKey is ZAZJGBCGMUKZEL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The canonical SMILES is CCN(CCOC(=O)C=C)S(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.
What is the CAS number of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The CAS number is 423-82-5.
What is the UNII of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The UNII is 7L81F9QVY8.
What is the hydrogen bond acceptor count of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The hydrogen bond acceptor count is 22.
What is the topological polar surface area of 2-(N-Ethylperfluorooctanesulfonamido)ethyl acrylate?
The topological polar surface area is 72.1?2.
※ Please kindly note that our products are for research use only.