What is the molecular formula of (2-Methylbutyl)amine?
The molecular formula of (2-Methylbutyl)amine is C5H13N.
What is the molecular weight of (2-Methylbutyl)amine?
The molecular weight of (2-Methylbutyl)amine is 87.16 g/mol.
What is the IUPAC name of (2-Methylbutyl)amine?
The IUPAC name of (2-Methylbutyl)amine is 2-methylbutan-1-amine.
What is the InChI of (2-Methylbutyl)amine?
The InChI of (2-Methylbutyl)amine is InChI=1S/C5H13N/c1-3-5(2)4-6/h5H,3-4,6H2,1-2H3.
What is the InChIKey of (2-Methylbutyl)amine?
The InChIKey of (2-Methylbutyl)amine is VJROPLWGFCORRM-UHFFFAOYSA-N.
What is the canonical SMILES of (2-Methylbutyl)amine?
The canonical SMILES of (2-Methylbutyl)amine is CCC(C)CN.
What is the CAS number of (2-Methylbutyl)amine?
The CAS number of (2-Methylbutyl)amine is 96-15-1.
What is the XLogP3-AA value of (2-Methylbutyl)amine?
The XLogP3-AA value of (2-Methylbutyl)amine is 1.
How many hydrogen bond donor count does (2-Methylbutyl)amine have?
(2-Methylbutyl)amine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does (2-Methylbutyl)amine have?
(2-Methylbutyl)amine has 1 hydrogen bond acceptor count.