What is the PubChem CID for 2-Methylallylamine hydrochloride?
The PubChem CID for 2-Methylallylamine hydrochloride is 11953772.
What is the molecular formula of 2-Methylallylamine hydrochloride?
The molecular formula of 2-Methylallylamine hydrochloride is C4H10ClN.
What is the molecular weight of 2-Methylallylamine hydrochloride?
The molecular weight of 2-Methylallylamine hydrochloride is 107.58 g/mol.
What are some synonyms for 2-Methylallylamine hydrochloride?
Some synonyms for 2-Methylallylamine hydrochloride are 28148-54-1, 2-methylprop-2-en-1-amine hydrochloride, (2-methylallyl)amine hydrochloride, and (2-Methylallyl)amine HCl.
What is the IUPAC name of 2-Methylallylamine hydrochloride?
The IUPAC name of 2-Methylallylamine hydrochloride is 2-methylprop-2-en-1-amine;hydrochloride.
What is the InChI of 2-Methylallylamine hydrochloride?
The InChI of 2-Methylallylamine hydrochloride is InChI=1S/C4H9N.ClH/c1-4(2)3-5;/h1,3,5H2,2H3;1H.
What is the InChIKey of 2-Methylallylamine hydrochloride?
The InChIKey of 2-Methylallylamine hydrochloride is IOXCSDPJYGPYFW-UHFFFAOYSA-N.
What is the CAS number of 2-Methylallylamine hydrochloride?
The CAS number of 2-Methylallylamine hydrochloride is 28148-54-1.
What is the European Community (EC) Number of 2-Methylallylamine hydrochloride?
The European Community (EC) Number of 2-Methylallylamine hydrochloride is 627-969-8.
Is 2-Methylallylamine hydrochloride a canonicalized compound?
Yes, 2-Methylallylamine hydrochloride is a canonicalized compound.
※ Please kindly note that our products are for research use only.