What is the molecular formula of 2-methyl-6-nitroaniline?
The molecular formula of 2-methyl-6-nitroaniline is C7H8N2O2.
What is the molecular weight of 2-methyl-6-nitroaniline?
The molecular weight of 2-methyl-6-nitroaniline is 152.15 g/mol.
What is the IUPAC name of 2-methyl-6-nitroaniline?
The IUPAC name of 2-methyl-6-nitroaniline is 2-methyl-6-nitroaniline.
What is the InChI of 2-methyl-6-nitroaniline?
The InChI of 2-methyl-6-nitroaniline is InChI=1S/C7H8N2O2/c1-5-3-2-4-6(7(5)8)9(10)11/h2-4H,8H2,1H3.
What is the InChIKey of 2-methyl-6-nitroaniline?
The InChIKey of 2-methyl-6-nitroaniline is FCMRHMPITHLLLA-UHFFFAOYSA-N.
What is the CAS number of 2-methyl-6-nitroaniline?
The CAS number of 2-methyl-6-nitroaniline is 570-24-1.
What is the UNII of 2-methyl-6-nitroaniline?
The UNII of 2-methyl-6-nitroaniline is OUP165YKBC.
What is the UN number of 2-methyl-6-nitroaniline?
The UN number of 2-methyl-6-nitroaniline is 2660.
What is the XLogP3-AA value of 2-methyl-6-nitroaniline?
The XLogP3-AA value of 2-methyl-6-nitroaniline is 2.
What is the topological polar surface area of 2-methyl-6-nitroaniline?
The topological polar surface area of 2-methyl-6-nitroaniline is 71.8Ų.