What is the molecular formula of 2-Methyl-1,3-propanediol?
The molecular formula of 2-Methyl-1,3-propanediol is C4H10O2.
What is the molecular weight of 2-Methyl-1,3-propanediol?
The molecular weight of 2-Methyl-1,3-propanediol is 90.12 g/mol.
What is the IUPAC name of 2-Methyl-1,3-propanediol?
The IUPAC name of 2-Methyl-1,3-propanediol is 2-methylpropane-1,3-diol.
What is the InChI of 2-Methyl-1,3-propanediol?
The InChI of 2-Methyl-1,3-propanediol is InChI=1S/C4H10O2/c1-4(2-5)3-6/h4-6H,2-3H2,1H3.
What is the InChIKey of 2-Methyl-1,3-propanediol?
The InChIKey of 2-Methyl-1,3-propanediol is QWGRWMMWNDWRQN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-1,3-propanediol?
The canonical SMILES of 2-Methyl-1,3-propanediol is CC(CO)CO.
What is the CAS number of 2-Methyl-1,3-propanediol?
The CAS number of 2-Methyl-1,3-propanediol is 2163-42-0.
How many hydrogen bond donor counts does 2-Methyl-1,3-propanediol have?
2-Methyl-1,3-propanediol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Methyl-1,3-propanediol have?
2-Methyl-1,3-propanediol has 2 hydrogen bond acceptor counts.