What is the molecular formula of 2-Methoxynaphthalene?
The molecular formula of 2-Methoxynaphthalene is C11H10O.
What is the molecular weight of 2-Methoxynaphthalene?
The molecular weight of 2-Methoxynaphthalene is 158.20 g/mol.
What is the IUPAC name of 2-Methoxynaphthalene?
The IUPAC name of 2-Methoxynaphthalene is 2-methoxynaphthalene.
What is the InChI of 2-Methoxynaphthalene?
The InChI of 2-Methoxynaphthalene is InChI=1S/C11H10O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3.
What is the InChIKey of 2-Methoxynaphthalene?
The InChIKey of 2-Methoxynaphthalene is LUZDYPLAQQGJEA-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methoxynaphthalene?
The canonical SMILES of 2-Methoxynaphthalene is COC1=CC2=CC=CC=C2C=C1.
What is the CAS number of 2-Methoxynaphthalene?
The CAS number of 2-Methoxynaphthalene is 93-04-9.
What is the European Community (EC) number of 2-Methoxynaphthalene?
The European Community (EC) number of 2-Methoxynaphthalene is 202-213-6.
What is the FEMA number of 2-Methoxynaphthalene?
The FEMA number of 2-Methoxynaphthalene is 4704.
What is the molecular weight of 2-Methoxynaphthalene according to PubChem?
The molecular weight of 2-Methoxynaphthalene is 158.20 g/mol according to PubChem.