What is the PubChem CID of 2-Isopropyl-piperazine?
The PubChem CID of 2-Isopropyl-piperazine is 558976.
What is the molecular formula of 2-Isopropyl-piperazine?
The molecular formula of 2-Isopropyl-piperazine is C7H16N2.
What is the molecular weight of 2-Isopropyl-piperazine?
The molecular weight of 2-Isopropyl-piperazine is 128.22 g/mol.
What are the synonyms of 2-Isopropyl-piperazine?
The synonyms of 2-Isopropyl-piperazine are 2-Isopropylpiperazine, 84468-53-1, 2-propan-2-ylpiperazine, 2-ISOPROPYL-PIPERAZINE, 2-(PROPAN-2-YL)PIPERAZINE.
What is the IUPAC name of 2-Isopropyl-piperazine?
The IUPAC name of 2-Isopropyl-piperazine is 2-propan-2-ylpiperazine.
What is the InChI of 2-Isopropyl-piperazine?
The InChI of 2-Isopropyl-piperazine is InChI=1S/C7H16N2/c1-6(2)7-5-8-3-4-9-7/h6-9H,3-5H2,1-2H3.
What is the InChIKey of 2-Isopropyl-piperazine?
The InChIKey of 2-Isopropyl-piperazine is HBCSNWKQNPKIHK-UHFFFAOYSA-N.
What is the exact mass of 2-Isopropyl-piperazine?
The exact mass of 2-Isopropyl-piperazine is 128.131348519 g/mol.
How many hydrogen bond donor counts does 2-Isopropyl-piperazine have?
2-Isopropyl-piperazine has 2 hydrogen bond donor counts.
What is the topological polar surface area of 2-Isopropyl-piperazine?
The topological polar surface area of 2-Isopropyl-piperazine is 24.1?2.