What is the molecular formula of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The molecular formula of 2-Isobutoxypyridine-3-boronic acid pinacol ester is C15H24BNO3.
What is the molecular weight of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The molecular weight of 2-Isobutoxypyridine-3-boronic acid pinacol ester is 277.17 g/mol.
What is the IUPAC name of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The IUPAC name of 2-Isobutoxypyridine-3-boronic acid pinacol ester is 2-(2-methylpropoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The InChI of 2-Isobutoxypyridine-3-boronic acid pinacol ester is InChI=1S/C15H24BNO3/c1-11(2)10-18-13-12(8-7-9-17-13)16-19-14(3,4)15(5,6)20-16/h7-9,11H,10H2,1-6H3.
What is the InChIKey of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The InChIKey of 2-Isobutoxypyridine-3-boronic acid pinacol ester is XJZKUZSIUOACPV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The canonical SMILES of 2-Isobutoxypyridine-3-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OCC(C)C.
What is the CAS number of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The CAS number of 2-Isobutoxypyridine-3-boronic acid pinacol ester is 1357397-80-8.
What is the hydrogen bond donor count of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The hydrogen bond donor count of 2-Isobutoxypyridine-3-boronic acid pinacol ester is 0.
What is the formal charge of 2-Isobutoxypyridine-3-boronic acid pinacol ester?
The formal charge of 2-Isobutoxypyridine-3-boronic acid pinacol ester is 0.
※ Please kindly note that our products are for research use only.