What is the molecular formula of 2-Iodoaniline?
The molecular formula of 2-Iodoaniline is C6H6IN.
What is the molecular weight of 2-Iodoaniline?
The molecular weight of 2-Iodoaniline is 219.02 g/mol.
What is the IUPAC name of 2-Iodoaniline?
The IUPAC name of 2-Iodoaniline is 2-iodoaniline.
What is the InChI of 2-Iodoaniline?
The InChI of 2-Iodoaniline is InChI=1S/C6H6IN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2.
What is the InChIKey of 2-Iodoaniline?
The InChIKey of 2-Iodoaniline is UBPDKIDWEADHPP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Iodoaniline?
The canonical SMILES of 2-Iodoaniline is C1=CC=C(C(=C1)N)I.
What is the CAS number of 2-Iodoaniline?
The CAS number of 2-Iodoaniline is 615-43-0.
How many hydrogen bond donor counts does 2-Iodoaniline have?
2-Iodoaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Iodoaniline have?
2-Iodoaniline has 1 hydrogen bond acceptor count.