The IUPAC name is 2-hydroxy-N-(4-methoxyphenyl)-11H-benzo[a]carbazole-3-carboxamide.
What is the InChI of the compound?
The InChI is InChI=1S/C24H18N2O3/c1-29-16-9-7-15(8-10-16)25-24(28)20-12-14-6-11-18-17-4-2-3-5-21(17)26-23(18)19(14)13-22(20)27/h2-13,26-27H,1H3,(H,25,28).
What is the InChIKey of the compound?
The InChIKey is HRNSEOMPRWUKQL-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is COC1=CC=C(C=C1)NC(=O)C2=C(C=C3C(=C2)C=CC4=C3NC5=CC=CC=C45)O.
What is the CAS number of the compound?
The CAS number is 86-19-1.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 5.6.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.