What is the molecular formula of 2-Hexyl-1-octanol?
The molecular formula of 2-Hexyl-1-octanol is C14H30O.
What is the molecular weight of 2-Hexyl-1-octanol?
The molecular weight of 2-Hexyl-1-octanol is 214.39 g/mol.
What is the IUPAC name of 2-Hexyl-1-octanol?
The IUPAC name of 2-Hexyl-1-octanol is 2-hexyloctan-1-ol.
What is the InChI of 2-Hexyl-1-octanol?
The InChI of 2-Hexyl-1-octanol is InChI=1S/C14H30O/c1-3-5-7-9-11-14(13-15)12-10-8-6-4-2/h14-15H,3-13H2,1-2H3.
What is the InChIKey of 2-Hexyl-1-octanol?
The InChIKey of 2-Hexyl-1-octanol is QNMCWJOEQBZQHB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Hexyl-1-octanol?
The canonical SMILES of 2-Hexyl-1-octanol is CCCCCCC(CCCCCC)CO.
What is the CAS number of 2-Hexyl-1-octanol?
The CAS number of 2-Hexyl-1-octanol is 19780-79-1.
What is the European Community (EC) number of 2-Hexyl-1-octanol?
The European Community (EC) number of 2-Hexyl-1-octanol is 606-381-5.
What is the UNII of 2-Hexyl-1-octanol?
The UNII of 2-Hexyl-1-octanol is 5D8007Z3JI.
Is 2-Hexyl-1-octanol classified as a canonicalized compound?
Yes, 2-Hexyl-1-octanol is classified as a canonicalized compound.