What is the PubChem CID of 2-Fluorothiophenol?
PubChem CID 520216.
What is the molecular formula of 2-Fluorothiophenol?
The molecular formula is C6H5FS.
What is the molecular weight of 2-Fluorothiophenol?
The molecular weight is 128.17 g/mol.
What is the IUPAC name of 2-Fluorothiophenol?
The IUPAC name is 2-fluorobenzenethiol.
What is the InChI of 2-Fluorothiophenol?
The InChI is InChI=1S/C6H5FS/c7-5-3-1-2-4-6(5)8/h1-4,8H.
What is the InChIKey of 2-Fluorothiophenol?
The InChIKey is WJTZZPVVTSDNJJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluorothiophenol?
The canonical SMILES is C1=CC=C(C(=C1)F)S.
What is the CAS number of 2-Fluorothiophenol?
The CAS number is 2557-78-0.
What is the EC number of 2-Fluorothiophenol?
The EC number is 628-769-3.
Is 2-Fluorothiophenol a covalently-bonded unit?
Yes, it is a covalently-bonded unit with a count of 1.