What is the molecular formula of 2-Fluorobenzylamine?
The molecular formula of 2-Fluorobenzylamine is C7H8FN.
What is the molecular weight of 2-Fluorobenzylamine?
The molecular weight of 2-Fluorobenzylamine is 125.14 g/mol.
What is the IUPAC name of 2-Fluorobenzylamine?
The IUPAC name of 2-Fluorobenzylamine is (2-fluorophenyl)methanamine.
What is the InChI of 2-Fluorobenzylamine?
The InChI of 2-Fluorobenzylamine is InChI=1S/C7H8FN/c8-7-4-2-1-3-6(7)5-9/h1-4H,5,9H2.
What is the InChIKey of 2-Fluorobenzylamine?
The InChIKey of 2-Fluorobenzylamine is LRFWYBZWRQWZIM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluorobenzylamine?
The canonical SMILES of 2-Fluorobenzylamine is C1=CC=C(C(=C1)CN)F.
What is the CAS number of 2-Fluorobenzylamine?
The CAS number of 2-Fluorobenzylamine is 89-99-6.
What is the European Community (EC) number of 2-Fluorobenzylamine?
The European Community (EC) number of 2-Fluorobenzylamine is 201-957-9.
What is the ChEMBL ID of 2-Fluorobenzylamine?
The ChEMBL ID of 2-Fluorobenzylamine is CHEMBL12892.
Is 2-Fluorobenzylamine considered a canonicalized compound?
Yes, 2-Fluorobenzylamine is considered a canonicalized compound.